C17H15ClO2S — CID 115788688
1-(1-benzothiophen-2-yl)-2-(5-chloro-2-methoxyphenyl)ethanol (PubChem CID 115788688) has the molecular formula C17H15ClO2S and a molecular weight of 318.83 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-2-(5-chloro-2-methoxyphenyl)ethanol.
| Compound Name | 1-(1-benzothiophen-2-yl)-2-(5-chloro-2-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 115788688 |
| Molecular Formula | C17H15ClO2S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-2-(5-chloro-2-methoxyphenyl)ethanol |
| SMILES | COc1ccc(Cl)cc1CC(O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C17H15ClO2S/c1-20-15-7-6-13(18)8-12(15)9-14(19)17-10-11-4-2-3-5-16(11)21-17/h2-8,10,14,19H,9H2,1H3 |
| InChIKey | CLDKCEPXDLNNMH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |