C42H61ClO7Si — CID 71110675
(2R,3R,4S,6S)-3,4-dibutoxy-6-(butoxymethyl)-2-[4-chloro-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-5-methoxyphenyl]oxan-2-ol (PubChem CID 71110675) has the molecular formula C42H61ClO7Si and a molecular weight of 741.48 g/mol. Its IUPAC name is (2R,3R,4S,6S)-3,4-dibutoxy-6-(butoxymethyl)-2-[4-chloro-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-5-methoxyphenyl]oxan-2-ol.
| Compound Name | (2R,3R,4S,6S)-3,4-dibutoxy-6-(butoxymethyl)-2-[4-chloro-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-5-methoxyphenyl]oxan-2-ol |
|---|---|
| PubChem CID | 71110675 |
| Molecular Formula | C42H61ClO7Si |
| Molecular Weight | 741.48 g/mol |
| Exact Mass | 740.39 |
| IUPAC Name | (2R,3R,4S,6S)-3,4-dibutoxy-6-(butoxymethyl)-2-[4-chloro-3-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]-5-methoxyphenyl]oxan-2-ol |
| SMILES | CCCCOC[C@@H]1C[C@H](OCCCC)[C@@H](OCCCC)[C@@](O)(c2cc(CCC(C)(C)[Si](O)(c3ccccc3)c3ccccc3)c(Cl)c(OC)c2)O1 |
| InChI | InChI=1S/C42H61ClO7Si/c1-7-10-25-47-31-34-30-38(48-26-11-8-2)40(49-27-12-9-3)42(44,50-34)33-28-32(39(43)37(29-33)46-6)23-24-41(4,5)51(45,35-19-15-13-16-20-35)36-21-17-14-18-22-36/h13-22,28-29,34,38,40,44-45H,7-12,23-27,30-31H2,1-6H3/t34-,38-,40+,42+/m0/s1 |
| InChIKey | AGBNDAPFHBVJHZ-QYNGWFCQSA-N |
| XLogP | 7.93 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.48 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|