C20H34O4Si — CID 139765356
dibutoxy-[3-(oxiran-2-ylmethoxy)propyl]-phenylsilane (PubChem CID 139765356) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is dibutoxy-[3-(oxiran-2-ylmethoxy)propyl]-phenylsilane.
| Compound Name | dibutoxy-[3-(oxiran-2-ylmethoxy)propyl]-phenylsilane |
|---|---|
| PubChem CID | 139765356 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | dibutoxy-[3-(oxiran-2-ylmethoxy)propyl]-phenylsilane |
| SMILES | CCCCO[Si](CCCOCC1CO1)(OCCCC)c1ccccc1 |
| InChI | InChI=1S/C20H34O4Si/c1-3-5-14-23-25(24-15-6-4-2,20-11-8-7-9-12-20)16-10-13-21-17-19-18-22-19/h7-9,11-12,19H,3-6,10,13-18H2,1-2H3 |
| InChIKey | DDMBKQYUQAERFL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|