C22H38O4Si2 — CID 14419243
[4-[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]phenyl]-dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 14419243) has the molecular formula C22H38O4Si2 and a molecular weight of 422.71 g/mol. Its IUPAC name is [4-[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]phenyl]-dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | [4-[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]phenyl]-dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 14419243 |
| Molecular Formula | C22H38O4Si2 |
| Molecular Weight | 422.71 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [4-[dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]phenyl]-dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | C[Si](C)(CCCOCC1CO1)c1ccc([Si](C)(C)CCCOCC2CO2)cc1 |
| InChI | InChI=1S/C22H38O4Si2/c1-27(2,13-5-11-23-15-19-17-25-19)21-7-9-22(10-8-21)28(3,4)14-6-12-24-16-20-18-26-20/h7-10,19-20H,5-6,11-18H2,1-4H3 |
| InChIKey | PEWAHDQMOPIBIS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.71 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|