C41H63ClO6 — CID 89036733
(2S,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-[4-chloro-5-[(4-ethylphenyl)methyl]-2-methoxyphenyl]-2-prop-2-enyloxane (PubChem CID 89036733) has the molecular formula C41H63ClO6 and a molecular weight of 687.40 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-[4-chloro-5-[(4-ethylphenyl)methyl]-2-methoxyphenyl]-2-prop-2-enyloxane.
| Compound Name | (2S,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-[4-chloro-5-[(4-ethylphenyl)methyl]-2-methoxyphenyl]-2-prop-2-enyloxane |
|---|---|
| PubChem CID | 89036733 |
| Molecular Formula | C41H63ClO6 |
| Molecular Weight | 687.40 g/mol |
| Exact Mass | 686.43 |
| IUPAC Name | (2S,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-[4-chloro-5-[(4-ethylphenyl)methyl]-2-methoxyphenyl]-2-prop-2-enyloxane |
| SMILES | C=CC[C@@]1(c2cc(Cc3ccc(CC)cc3)c(Cl)cc2OC)O[C@H](COCCCC)[C@@H](OCCCC)[C@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C41H63ClO6/c1-8-14-23-44-30-37-38(45-24-15-9-2)39(46-25-16-10-3)40(47-26-17-11-4)41(48-37,22-12-5)34-28-33(35(42)29-36(34)43-7)27-32-20-18-31(13-6)19-21-32/h12,18-21,28-29,37-40H,5,8-11,13-17,22-27,30H2,1-4,6-7H3/t37-,38-,39+,40-,41+/m1/s1 |
| InChIKey | RCYWIQZYOSCWQP-WEOXEBIHSA-N |
| XLogP | 10.04 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.40 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|