C41H63ClO6 — CID 70855589
(3'R,4S,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)-7-chloro-6-[(4-ethylphenyl)methyl]-2,2-dimethylspiro[3H-chromene-4,2'-oxane] (PubChem CID 70855589) has the molecular formula C41H63ClO6 and a molecular weight of 687.40 g/mol. Its IUPAC name is (3'R,4S,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)-7-chloro-6-[(4-ethylphenyl)methyl]-2,2-dimethylspiro[3H-chromene-4,2'-oxane].
| Compound Name | (3'R,4S,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)-7-chloro-6-[(4-ethylphenyl)methyl]-2,2-dimethylspiro[3H-chromene-4,2'-oxane] |
|---|---|
| PubChem CID | 70855589 |
| Molecular Formula | C41H63ClO6 |
| Molecular Weight | 687.40 g/mol |
| Exact Mass | 686.43 |
| IUPAC Name | (3'R,4S,4'S,5'R,6'R)-3',4',5'-tributoxy-6'-(butoxymethyl)-7-chloro-6-[(4-ethylphenyl)methyl]-2,2-dimethylspiro[3H-chromene-4,2'-oxane] |
| SMILES | CCCCOC[C@H]1O[C@]2(CC(C)(C)Oc3cc(Cl)c(Cc4ccc(CC)cc4)cc32)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C41H63ClO6/c1-8-13-21-43-28-36-37(44-22-14-9-2)38(45-23-15-10-3)39(46-24-16-11-4)41(48-36)29-40(6,7)47-35-27-34(42)32(26-33(35)41)25-31-19-17-30(12-5)18-20-31/h17-20,26-27,36-39H,8-16,21-25,28-29H2,1-7H3/t36-,37-,38+,39-,41+/m1/s1 |
| InChIKey | MMVGFLPCFDHCQR-GCKSPRBUSA-N |
| XLogP | 10.02 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.40 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|