C29H39ClO4 — CID 70986712
4-butoxy-2-(butoxymethyl)-6-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-3,6-dihydro-2H-pyran-3-ol (PubChem CID 70986712) has the molecular formula C29H39ClO4 and a molecular weight of 487.08 g/mol. Its IUPAC name is 4-butoxy-2-(butoxymethyl)-6-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | 4-butoxy-2-(butoxymethyl)-6-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 70986712 |
| Molecular Formula | C29H39ClO4 |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 4-butoxy-2-(butoxymethyl)-6-[4-chloro-3-[(4-ethylphenyl)methyl]phenyl]-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CCCCOCC1OC(c2ccc(Cl)c(Cc3ccc(CC)cc3)c2)C=C(OCCCC)C1O |
| InChI | InChI=1S/C29H39ClO4/c1-4-7-15-32-20-28-29(31)27(33-16-8-5-2)19-26(34-28)23-13-14-25(30)24(18-23)17-22-11-9-21(6-3)10-12-22/h9-14,18-19,26,28-29,31H,4-8,15-17,20H2,1-3H3 |
| InChIKey | KTVSDOMCHZHAKT-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|