C49H73ClO6Si — CID 90454218
[4-[4-but-3-enyl-2-chloro-5-[(3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenyl]-2-methylbutan-2-yl]-hydroxy-diphenylsilane (PubChem CID 90454218) has the molecular formula C49H73ClO6Si and a molecular weight of 821.66 g/mol. Its IUPAC name is [4-[4-but-3-enyl-2-chloro-5-[(3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenyl]-2-methylbutan-2-yl]-hydroxy-diphenylsilane.
| Compound Name | [4-[4-but-3-enyl-2-chloro-5-[(3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenyl]-2-methylbutan-2-yl]-hydroxy-diphenylsilane |
|---|---|
| PubChem CID | 90454218 |
| Molecular Formula | C49H73ClO6Si |
| Molecular Weight | 821.66 g/mol |
| Exact Mass | 820.49 |
| IUPAC Name | [4-[4-but-3-enyl-2-chloro-5-[(3S,4R,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]phenyl]-2-methylbutan-2-yl]-hydroxy-diphenylsilane |
| SMILES | C=CCCc1cc(Cl)c(CCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)cc1C1O[C@H](COCCCC)[C@@H](OCCCC)[C@H](OCCCC)C1OCCCC |
| InChI | InChI=1S/C49H73ClO6Si/c1-8-13-24-38-36-43(50)39(29-30-49(6,7)57(51,40-25-20-18-21-26-40)41-27-22-19-23-28-41)35-42(38)45-47(54-33-16-11-4)48(55-34-17-12-5)46(53-32-15-10-3)44(56-45)37-52-31-14-9-2/h8,18-23,25-28,35-36,44-48,51H,1,9-17,24,29-34,37H2,2-7H3/t44-,45?,46-,47?,48+/m1/s1 |
| InChIKey | ZDDMFJPQQCJBLX-LKLXBYQDSA-N |
| XLogP | 10.74 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.66 |
| LogP ≤ 5 | 10.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|