C54H52O8S — CID 69476139
2-[4-(2-phenyl-1-thiophen-2-ylethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenoxy]acetic acid (PubChem CID 69476139) has the molecular formula C54H52O8S and a molecular weight of 861.07 g/mol. Its IUPAC name is 2-[4-(2-phenyl-1-thiophen-2-ylethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-(2-phenyl-1-thiophen-2-ylethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 69476139 |
| Molecular Formula | C54H52O8S |
| Molecular Weight | 861.07 g/mol |
| Exact Mass | 860.34 |
| IUPAC Name | 2-[4-(2-phenyl-1-thiophen-2-ylethyl)-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C(Cc2ccccc2)c2cccs2)cc1[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C54H52O8S/c55-50(56)38-58-47-29-28-44(45(49-27-16-30-63-49)31-39-17-6-1-7-18-39)32-46(47)51-53(60-35-42-23-12-4-13-24-42)54(61-36-43-25-14-5-15-26-43)52(59-34-41-21-10-3-11-22-41)48(62-51)37-57-33-40-19-8-2-9-20-40/h1-30,32,45,48,51-54H,31,33-38H2,(H,55,56)/t45?,48-,51+,52-,53?,54+/m1/s1 |
| InChIKey | IXRCSCWYWQOXEV-HHOWKOOBSA-N |
| XLogP | 11.00 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 861.07 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |