C36H60N2O5 — CID 90291661
4-[(4-ethylphenyl)methyl]-3,5-dimethyl-1-[(2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]pyrazole (PubChem CID 90291661) has the molecular formula C36H60N2O5 and a molecular weight of 600.89 g/mol. Its IUPAC name is 4-[(4-ethylphenyl)methyl]-3,5-dimethyl-1-[(2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]pyrazole.
| Compound Name | 4-[(4-ethylphenyl)methyl]-3,5-dimethyl-1-[(2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]pyrazole |
|---|---|
| PubChem CID | 90291661 |
| Molecular Formula | C36H60N2O5 |
| Molecular Weight | 600.89 g/mol |
| Exact Mass | 600.45 |
| IUPAC Name | 4-[(4-ethylphenyl)methyl]-3,5-dimethyl-1-[(2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)oxan-2-yl]pyrazole |
| SMILES | CCCCOC[C@H]1O[C@@H](n2nc(C)c(Cc3ccc(CC)cc3)c2C)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C36H60N2O5/c1-8-13-21-39-26-32-33(40-22-14-9-2)34(41-23-15-10-3)35(42-24-16-11-4)36(43-32)38-28(7)31(27(6)37-38)25-30-19-17-29(12-5)18-20-30/h17-20,32-36H,8-16,21-26H2,1-7H3/t32-,33-,34+,35-,36-/m1/s1 |
| InChIKey | XJRFNOZORJJEGO-SQGINLDNSA-N |
| XLogP | 7.92 |
| TPSA | 63.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.89 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|