C23H36N2O6 — CID 70995491
3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid (PubChem CID 70995491) has the molecular formula C23H36N2O6 and a molecular weight of 436.55 g/mol. Its IUPAC name is 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid.
| Compound Name | 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 70995491 |
| Molecular Formula | C23H36N2O6 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid |
| SMILES | CCCCOCC1OC(n2ccc(C#N)c2C(=O)O)C(OCCCC)C1OCCCC |
| InChI | InChI=1S/C23H36N2O6/c1-4-7-12-28-16-18-20(29-13-8-5-2)21(30-14-9-6-3)22(31-18)25-11-10-17(15-24)19(25)23(26)27/h10-11,18,20-22H,4-9,12-14,16H2,1-3H3,(H,26,27) |
| InChIKey | VUTAKDUOWXVHAO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|