About 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid
3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid (PubChem CID 70995491) has the molecular formula C23H36N2O6
and a molecular weight of 436.55 g/mol. Its IUPAC name is 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid |
| PubChem CID | 70995491 |
| Molecular Formula | C23H36N2O6 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid |
| SMILES | CCCCOCC1OC(n2ccc(C#N)c2C(=O)O)C(OCCCC)C1OCCCC |
| InChI | InChI=1S/C23H36N2O6/c1-4-7-12-28-16-18-20(29-13-8-5-2)21(30-14-9-6-3)22(31-18)25-11-10-17(15-24)19(25)23(26)27/h10-11,18,20-22H,4-9,12-14,16H2,1-3H3,(H,26,27) |
| InChIKey | VUTAKDUOWXVHAO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid?
The IUPAC name of 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid (CID 70995491) is 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid.
What is the SMILES notation for 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid?
The canonical SMILES for 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid is CCCCOCC1OC(n2ccc(C#N)c2C(=O)O)C(OCCCC)C1OCCCC.
What is the InChIKey of 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid?
The InChIKey is VUTAKDUOWXVHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H36N2O6/c1-4-7-12-28-16-18-20(29-13-8-5-2)21(30-14-9-6-3)22(31-18)25-11-10-17(15-24)19(25)23(26)27/h10-11,18,20-22H,4-9,12-14,16H2,1-3H3,(H,26,27).
What are the key properties of 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid?
3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid has a molecular weight of 436.55 g/mol, XLogP of 4.14, 15 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-1-[3,4-dibutoxy-5-(butoxymethyl)oxolan-2-yl]pyrrole-2-carboxylic acid is sourced from PubChem (CID 70995491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).