C47H43ClN4O5S — CID 67287594
2-[[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methyl]-5-pyrazin-2-yl-1,3,4-thiadiazole (PubChem CID 67287594) has the molecular formula C47H43ClN4O5S and a molecular weight of 811.40 g/mol. Its IUPAC name is 2-[[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methyl]-5-pyrazin-2-yl-1,3,4-thiadiazole.
| Compound Name | 2-[[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methyl]-5-pyrazin-2-yl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 67287594 |
| Molecular Formula | C47H43ClN4O5S |
| Molecular Weight | 811.40 g/mol |
| Exact Mass | 810.26 |
| IUPAC Name | 2-[[2-chloro-5-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]phenyl]methyl]-5-pyrazin-2-yl-1,3,4-thiadiazole |
| SMILES | Clc1ccc([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)cc1Cc1nnc(-c2cnccn2)s1 |
| InChI | InChI=1S/C47H43ClN4O5S/c48-39-22-21-37(25-38(39)26-42-51-52-47(58-42)40-27-49-23-24-50-40)43-45(55-30-35-17-9-3-10-18-35)46(56-31-36-19-11-4-12-20-36)44(54-29-34-15-7-2-8-16-34)41(57-43)32-53-28-33-13-5-1-6-14-33/h1-25,27,41,43-46H,26,28-32H2/t41-,43+,44-,45?,46+/m1/s1 |
| InChIKey | RAHCEWASOGLBTJ-FVOIRNEVSA-N |
| XLogP | 9.65 |
| TPSA | 97.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.40 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |