C27H28N2O6S — CID 89492705
[(2S,3R,4S,5R,6R)-3-acetyloxy-2-[4-cyano-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-ethyl-5-methyloxan-4-yl] acetate (PubChem CID 89492705) has the molecular formula C27H28N2O6S and a molecular weight of 508.60 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-3-acetyloxy-2-[4-cyano-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-ethyl-5-methyloxan-4-yl] acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-3-acetyloxy-2-[4-cyano-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-ethyl-5-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 89492705 |
| Molecular Formula | C27H28N2O6S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3-acetyloxy-2-[4-cyano-3-[[5-(furan-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-6-ethyl-5-methyloxan-4-yl] acetate |
| SMILES | CC[C@H]1O[C@@H](c2ccc(C#N)c(Cc3ncc(-c4ccco4)s3)c2)C(OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C27H28N2O6S/c1-5-21-15(2)25(33-16(3)30)27(34-17(4)31)26(35-21)18-8-9-19(13-28)20(11-18)12-24-29-14-23(36-24)22-7-6-10-32-22/h6-11,14-15,21,25-27H,5,12H2,1-4H3/t15-,21-,25+,26+,27?/m1/s1 |
| InChIKey | AYONYYCOKNXGSF-XOEKRPIPSA-N |
| XLogP | 5.21 |
| TPSA | 111.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |