C26H25NO6S — CID 54769310
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-hydroxy-3-[(5-phenyl-1,3-thiazol-2-yl)methyl]naphthalen-1-yl]oxane-3,4,5-triol (PubChem CID 54769310) has the molecular formula C26H25NO6S and a molecular weight of 479.55 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-hydroxy-3-[(5-phenyl-1,3-thiazol-2-yl)methyl]naphthalen-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-hydroxy-3-[(5-phenyl-1,3-thiazol-2-yl)methyl]naphthalen-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 54769310 |
| Molecular Formula | C26H25NO6S |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-hydroxy-3-[(5-phenyl-1,3-thiazol-2-yl)methyl]naphthalen-1-yl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cc(Cc3ncc(-c4ccccc4)s3)c(O)c3ccccc23)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H25NO6S/c28-13-19-23(30)24(31)25(32)26(33-19)18-10-15(22(29)17-9-5-4-8-16(17)18)11-21-27-12-20(34-21)14-6-2-1-3-7-14/h1-10,12,19,23-26,28-32H,11,13H2/t19-,23-,24+,25-,26+/m1/s1 |
| InChIKey | RNDFCPZWWSMECM-FRTMRTDSSA-N |
| XLogP | 2.77 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |