C23H24O6S — CID 154638806
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[2-hydroxy-4-[(4-thiophen-2-ylphenyl)methyl]phenyl]oxane-3,4,5-triol (PubChem CID 154638806) has the molecular formula C23H24O6S and a molecular weight of 428.51 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[2-hydroxy-4-[(4-thiophen-2-ylphenyl)methyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[2-hydroxy-4-[(4-thiophen-2-ylphenyl)methyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 154638806 |
| Molecular Formula | C23H24O6S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[2-hydroxy-4-[(4-thiophen-2-ylphenyl)methyl]phenyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cc3ccc(-c4cccs4)cc3)cc2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H24O6S/c24-12-18-20(26)21(27)22(28)23(29-18)16-8-5-14(11-17(16)25)10-13-3-6-15(7-4-13)19-2-1-9-30-19/h1-9,11,18,20-28H,10,12H2/t18-,20-,21+,22-,23+/m1/s1 |
| InChIKey | ZDVSUWHZPOCHOW-IFPLKCGESA-N |
| XLogP | 2.23 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |