C19H20O5S2 — CID 58843377
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-(thieno[2,3-b]thiophen-5-ylmethyl)phenyl]oxane-3,4,5-triol (PubChem CID 58843377) has the molecular formula C19H20O5S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-(thieno[2,3-b]thiophen-5-ylmethyl)phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-(thieno[2,3-b]thiophen-5-ylmethyl)phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58843377 |
| Molecular Formula | C19H20O5S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-(thieno[2,3-b]thiophen-5-ylmethyl)phenyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cccc(Cc3cc4ccsc4s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H20O5S2/c20-9-14-15(21)16(22)17(23)18(24-14)11-3-1-2-10(6-11)7-13-8-12-4-5-25-19(12)26-13/h1-6,8,14-18,20-23H,7,9H2/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | CWZFFLDZKVVNRC-SFFUCWETSA-N |
| XLogP | 2.07 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |