C19H20O6S2 — CID 58843593
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[2-hydroxy-5-(thieno[2,3-b]thiophen-5-ylmethyl)phenyl]oxane-3,4,5-triol (PubChem CID 58843593) has the molecular formula C19H20O6S2 and a molecular weight of 408.50 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[2-hydroxy-5-(thieno[2,3-b]thiophen-5-ylmethyl)phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[2-hydroxy-5-(thieno[2,3-b]thiophen-5-ylmethyl)phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58843593 |
| Molecular Formula | C19H20O6S2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[2-hydroxy-5-(thieno[2,3-b]thiophen-5-ylmethyl)phenyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cc(Cc3cc4ccsc4s3)ccc2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H20O6S2/c20-8-14-15(22)16(23)17(24)18(25-14)12-6-9(1-2-13(12)21)5-11-7-10-3-4-26-19(10)27-11/h1-4,6-7,14-18,20-24H,5,8H2/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | IXAAZMYQFRNUGY-SFFUCWETSA-N |
| XLogP | 1.77 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |