C24H31FN2O5 — CID 175444533
(2R)-2-[2-fluoro-4-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 175444533) has the molecular formula C24H31FN2O5 and a molecular weight of 446.52 g/mol. Its IUPAC name is (2R)-2-[2-fluoro-4-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R)-2-[2-fluoro-4-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 175444533 |
| Molecular Formula | C24H31FN2O5 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (2R)-2-[2-fluoro-4-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CN1CCN(c2ccc(Cc3ccc([C@H]4OC(CO)C(O)C(O)C4O)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C24H31FN2O5/c1-26-8-10-27(11-9-26)17-5-2-15(3-6-17)12-16-4-7-18(19(25)13-16)24-23(31)22(30)21(29)20(14-28)32-24/h2-7,13,20-24,28-31H,8-12,14H2,1H3/t20?,21?,22?,23?,24-/m1/s1 |
| InChIKey | ZPUIAKSGRVCYAY-AQPGXQJPSA-N |
| XLogP | 0.68 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|