C23H26O6 — CID 71057560
(2R,3S,4R,5R)-2-(hydroxymethyl)-6-[2-hydroxy-5-[(5-methyl-1H-inden-2-yl)methyl]phenyl]oxane-3,4,5-triol (PubChem CID 71057560) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-6-[2-hydroxy-5-[(5-methyl-1H-inden-2-yl)methyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-6-[2-hydroxy-5-[(5-methyl-1H-inden-2-yl)methyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71057560 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-6-[2-hydroxy-5-[(5-methyl-1H-inden-2-yl)methyl]phenyl]oxane-3,4,5-triol |
| SMILES | Cc1ccc2c(c1)C=C(Cc1ccc(O)c(C3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c1)C2 |
| InChI | InChI=1S/C23H26O6/c1-12-2-4-15-8-14(9-16(15)6-12)7-13-3-5-18(25)17(10-13)23-22(28)21(27)20(26)19(11-24)29-23/h2-6,9-10,19-28H,7-8,11H2,1H3/t19-,20-,21+,22-,23?/m1/s1 |
| InChIKey | AKGIBNSTEXJNGC-HZQGQDIUSA-N |
| XLogP | 1.40 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |