C22H23FO5 — CID 170378887
(2S,3R,4R,5S,6R)-2-[4-fluoro-3-(1H-inden-2-ylmethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 170378887) has the molecular formula C22H23FO5 and a molecular weight of 386.42 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-fluoro-3-(1H-inden-2-ylmethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-fluoro-3-(1H-inden-2-ylmethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 170378887 |
| Molecular Formula | C22H23FO5 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-fluoro-3-(1H-inden-2-ylmethyl)phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(F)c(CC3=Cc4ccccc4C3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H23FO5/c23-17-6-5-15(22-21(27)20(26)19(25)18(11-24)28-22)10-16(17)9-12-7-13-3-1-2-4-14(13)8-12/h1-7,10,18-22,24-27H,8-9,11H2/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | SLYVMQWOZLGQCM-BDHVOXNPSA-N |
| XLogP | 1.52 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |