C21H23ClO7S — CID 66606997
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(1,1-dihydroxy-1-benzothiophen-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 66606997) has the molecular formula C21H23ClO7S and a molecular weight of 454.93 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(1,1-dihydroxy-1-benzothiophen-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(1,1-dihydroxy-1-benzothiophen-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 66606997 |
| Molecular Formula | C21H23ClO7S |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(1,1-dihydroxy-1-benzothiophen-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(CC3=Cc4ccccc4S3(O)O)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H23ClO7S/c22-15-6-5-12(21-20(26)19(25)18(24)16(10-23)29-21)7-13(15)9-14-8-11-3-1-2-4-17(11)30(14,27)28/h1-8,16,18-21,23-28H,9-10H2/t16-,18-,19+,20-,21+/m1/s1 |
| InChIKey | SCPBVYKPNADVIZ-RQXATKFSSA-N |
| XLogP | 2.56 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |