C28H35F3O6 — CID 66583045
(3R,4R,5S,6R)-2-[3-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 66583045) has the molecular formula C28H35F3O6 and a molecular weight of 524.58 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2-[3-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-2-[3-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 66583045 |
| Molecular Formula | C28H35F3O6 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | (3R,4R,5S,6R)-2-[3-[[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]methyl]-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1OC(c2ccc(F)c(Cc3ccc(OCC4CCC(CF)(CF)CC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C28H35F3O6/c29-15-28(16-30)9-7-18(8-10-28)14-36-21-4-1-17(2-5-21)11-20-12-19(3-6-22(20)31)27-26(35)25(34)24(33)23(13-32)37-27/h1-6,12,18,23-27,32-35H,7-11,13-16H2/t23-,24-,25+,26-,27?/m1/s1 |
| InChIKey | NYCZEOVSZOJPLP-MZIUKZFCSA-N |
| XLogP | 3.43 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |