C29H38F2O6 — CID 66583042
(2S,3R,4R,5S,6R)-2-[3-[2-[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]ethyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 66583042) has the molecular formula C29H38F2O6 and a molecular weight of 520.61 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[2-[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]ethyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[2-[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]ethyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 66583042 |
| Molecular Formula | C29H38F2O6 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[2-[4-[[4,4-bis(fluoromethyl)cyclohexyl]methoxy]phenyl]ethyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cccc(CCc3ccc(OCC4CCC(CF)(CF)CC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H38F2O6/c30-17-29(18-31)12-10-21(11-13-29)16-36-23-8-6-19(7-9-23)4-5-20-2-1-3-22(14-20)28-27(35)26(34)25(33)24(15-32)37-28/h1-3,6-9,14,21,24-28,32-35H,4-5,10-13,15-18H2/t24-,25-,26+,27-,28+/m1/s1 |
| InChIKey | CHVNEEBNIHACLR-DFLSAPQXSA-N |
| XLogP | 3.48 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |