C25H26O6 — CID 10127088
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(4-phenoxyphenyl)methyl]phenyl]oxane-3,4,5-triol (PubChem CID 10127088) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(4-phenoxyphenyl)methyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(4-phenoxyphenyl)methyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10127088 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[3-[(4-phenoxyphenyl)methyl]phenyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cccc(Cc3ccc(Oc4ccccc4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H26O6/c26-15-21-22(27)23(28)24(29)25(31-21)18-6-4-5-17(14-18)13-16-9-11-20(12-10-16)30-19-7-2-1-3-8-19/h1-12,14,21-29H,13,15H2/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | KSTYFKRNVDRYGA-RXFVIIJJSA-N |
| XLogP | 2.58 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |