C20H25NO7S — CID 10173356
N-[4-[[3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]methanesulfonamide (PubChem CID 10173356) has the molecular formula C20H25NO7S and a molecular weight of 423.49 g/mol. Its IUPAC name is N-[4-[[3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[[3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 10173356 |
| Molecular Formula | C20H25NO7S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[4-[[3-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(Cc2cccc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1 |
| InChI | InChI=1S/C20H25NO7S/c1-29(26,27)21-15-7-5-12(6-8-15)9-13-3-2-4-14(10-13)20-19(25)18(24)17(23)16(11-22)28-20/h2-8,10,16-25H,9,11H2,1H3/t16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | NPADPNSXUJBDSQ-OBKDMQGPSA-N |
| XLogP | 0.16 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |