C25H23F3O6 — CID 154638816
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]phenyl]oxane-3,4,5-triol (PubChem CID 154638816) has the molecular formula C25H23F3O6 and a molecular weight of 476.45 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 154638816 |
| Molecular Formula | C25H23F3O6 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-[[4-(2,4,5-trifluorophenoxy)phenyl]methyl]phenyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cc3ccc(Oc4cc(F)c(F)cc4F)cc3)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H23F3O6/c26-17-10-19(28)20(11-18(17)27)33-16-7-3-14(4-8-16)9-13-1-5-15(6-2-13)25-24(32)23(31)22(30)21(12-29)34-25/h1-8,10-11,21-25,29-32H,9,12H2/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | MEZLTRHLYUTRJM-RXFVIIJJSA-N |
| XLogP | 3.00 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|