C18H21NO7 — CID 118710061
7-methyl-3-oxo-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-naphthalene-2-carboxamide (PubChem CID 118710061) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is 7-methyl-3-oxo-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-naphthalene-2-carboxamide.
| Compound Name | 7-methyl-3-oxo-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 118710061 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 7-methyl-3-oxo-N-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-naphthalene-2-carboxamide |
| SMILES | Cc1ccc2c(c1)C=C(C(=O)N[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(=O)C2 |
| InChI | InChI=1S/C18H21NO7/c1-8-2-3-9-6-12(21)11(5-10(9)4-8)17(25)19-18-16(24)15(23)14(22)13(7-20)26-18/h2-5,13-16,18,20,22-24H,6-7H2,1H3,(H,19,25)/t13-,14-,15+,16-,18-/m1/s1 |
| InChIKey | BDSDXZZGIGLZEB-XLKGFZLASA-N |
| XLogP | -1.58 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|