C13H19NO6S — CID 102255185
5-ethyl-N-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiophene-2-carboxamide (PubChem CID 102255185) has the molecular formula C13H19NO6S and a molecular weight of 317.36 g/mol. Its IUPAC name is 5-ethyl-N-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-ethyl-N-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 102255185 |
| Molecular Formula | C13H19NO6S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 5-ethyl-N-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]thiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)NC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)s1 |
| InChI | InChI=1S/C13H19NO6S/c1-2-6-3-4-8(21-6)12(19)14-13-11(18)10(17)9(16)7(5-15)20-13/h3-4,7,9-11,13,15-18H,2,5H2,1H3,(H,14,19)/t7-,9-,10+,11-,13?/m1/s1 |
| InChIKey | RPXVZVQNSLNAEA-KPCWAIEQSA-N |
| XLogP | -1.16 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |