C22H25NO6 — CID 123190401
4-[2-(4-methylphenyl)ethenyl]-N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide (PubChem CID 123190401) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is 4-[2-(4-methylphenyl)ethenyl]-N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide.
| Compound Name | 4-[2-(4-methylphenyl)ethenyl]-N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide |
|---|---|
| PubChem CID | 123190401 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-[2-(4-methylphenyl)ethenyl]-N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]benzamide |
| SMILES | Cc1ccc(C=Cc2ccc(C(=O)NC3OC(CO)C(O)C(O)C3O)cc2)cc1 |
| InChI | InChI=1S/C22H25NO6/c1-13-2-4-14(5-3-13)6-7-15-8-10-16(11-9-15)21(28)23-22-20(27)19(26)18(25)17(12-24)29-22/h2-11,17-20,22,24-27H,12H2,1H3,(H,23,28) |
| InChIKey | OJQPLHARZYAHOK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|