C25H26FO7S2- — CID 163202587
1-[(2R,3S,4R,5R,6R)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-3,4,5-trihydroxyoxan-2-yl]ethanesulfonate (PubChem CID 163202587) has the molecular formula C25H26FO7S2- and a molecular weight of 521.61 g/mol. Its IUPAC name is 1-[(2R,3S,4R,5R,6R)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-3,4,5-trihydroxyoxan-2-yl]ethanesulfonate.
| Compound Name | 1-[(2R,3S,4R,5R,6R)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-3,4,5-trihydroxyoxan-2-yl]ethanesulfonate |
|---|---|
| PubChem CID | 163202587 |
| Molecular Formula | C25H26FO7S2- |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 1-[(2R,3S,4R,5R,6R)-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-3,4,5-trihydroxyoxan-2-yl]ethanesulfonate |
| SMILES | Cc1ccc([C@H]2O[C@@H](C(C)S(=O)(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C25H27FO7S2/c1-13-3-4-16(25-23(29)21(27)22(28)24(33-25)14(2)35(30,31)32)11-17(13)12-19-9-10-20(34-19)15-5-7-18(26)8-6-15/h3-11,14,21-25,27-29H,12H2,1-2H3,(H,30,31,32)/p-1/t14?,21-,22-,23+,24-,25+/m0/s1 |
| InChIKey | DNLIVGUFTGXHQD-MPMKRXGYSA-M |
| XLogP | 2.91 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|