C28H33FOS — CID 58224010
(2R,3S,4S,5R)-2-ethyl-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-3,4,5-trimethyloxane (PubChem CID 58224010) has the molecular formula C28H33FOS and a molecular weight of 436.64 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-ethyl-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-3,4,5-trimethyloxane.
| Compound Name | (2R,3S,4S,5R)-2-ethyl-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 58224010 |
| Molecular Formula | C28H33FOS |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (2R,3S,4S,5R)-2-ethyl-6-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-3,4,5-trimethyloxane |
| SMILES | CC[C@H]1OC(c2ccc(C)c(Cc3ccc(-c4ccc(F)cc4)s3)c2)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C28H33FOS/c1-6-26-19(4)18(3)20(5)28(30-26)22-8-7-17(2)23(15-22)16-25-13-14-27(31-25)21-9-11-24(29)12-10-21/h7-15,18-20,26,28H,6,16H2,1-5H3/t18-,19-,20?,26+,28?/m0/s1 |
| InChIKey | DTYUXWFEZFMGBO-JWDQVDOTSA-N |
| XLogP | 8.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |