C30H28FO8S-3 — CID 163202579
2-[(2S,3S,4R,5R,6R)-3,5-bis(carboxylatomethyl)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-yl]acetate (PubChem CID 163202579) has the molecular formula C30H28FO8S-3 and a molecular weight of 567.61 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R,6R)-3,5-bis(carboxylatomethyl)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-yl]acetate.
| Compound Name | 2-[(2S,3S,4R,5R,6R)-3,5-bis(carboxylatomethyl)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-yl]acetate |
|---|---|
| PubChem CID | 163202579 |
| Molecular Formula | C30H28FO8S-3 |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 2-[(2S,3S,4R,5R,6R)-3,5-bis(carboxylatomethyl)-2-[3-[[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxan-4-yl]acetate |
| SMILES | Cc1ccc([C@H]2O[C@@H](CO)[C@H](CC(=O)[O-])[C@H](CC(=O)[O-])[C@@H]2CC(=O)[O-])cc1Cc1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C30H31FO8S/c1-16-2-3-18(10-19(16)11-21-8-9-26(40-21)17-4-6-20(31)7-5-17)30-24(14-29(37)38)22(12-27(33)34)23(13-28(35)36)25(15-32)39-30/h2-10,22-25,30,32H,11-15H2,1H3,(H,33,34)(H,35,36)(H,37,38)/p-3/t22-,23+,24-,25-,30+/m0/s1 |
| InChIKey | MHBOWXOZXYYYDG-XVVHTVDDSA-K |
| XLogP | 1.15 |
| TPSA | 149.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |