C26H29ClFNOS — CID 58224009
5-[5-[[2-chloro-5-[(2R,3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]phenyl]methyl]thiophen-2-yl]-2-fluoropyridine (PubChem CID 58224009) has the molecular formula C26H29ClFNOS and a molecular weight of 458.04 g/mol. Its IUPAC name is 5-[5-[[2-chloro-5-[(2R,3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]phenyl]methyl]thiophen-2-yl]-2-fluoropyridine.
| Compound Name | 5-[5-[[2-chloro-5-[(2R,3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]phenyl]methyl]thiophen-2-yl]-2-fluoropyridine |
|---|---|
| PubChem CID | 58224009 |
| Molecular Formula | C26H29ClFNOS |
| Molecular Weight | 458.04 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 5-[5-[[2-chloro-5-[(2R,3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]phenyl]methyl]thiophen-2-yl]-2-fluoropyridine |
| SMILES | CC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(-c4ccc(F)nc4)s3)c2)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C26H29ClFNOS/c1-5-23-16(3)15(2)17(4)26(30-23)18-6-9-22(27)20(12-18)13-21-8-10-24(31-21)19-7-11-25(28)29-14-19/h6-12,14-17,23,26H,5,13H2,1-4H3/t15-,16-,17?,23+,26+/m0/s1 |
| InChIKey | ZACHBRJTDWURLE-JEFIBDDCSA-N |
| XLogP | 7.95 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.04 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|