C24H24ClNO6S — CID 66607236
4-[5-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]thiophen-2-yl]benzamide (PubChem CID 66607236) has the molecular formula C24H24ClNO6S and a molecular weight of 489.98 g/mol. Its IUPAC name is 4-[5-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]thiophen-2-yl]benzamide.
| Compound Name | 4-[5-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 66607236 |
| Molecular Formula | C24H24ClNO6S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 4-[5-[[2-chloro-5-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]thiophen-2-yl]benzamide |
| SMILES | NC(=O)c1ccc(-c2ccc(Cc3cc([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)C4O)ccc3Cl)s2)cc1 |
| InChI | InChI=1S/C24H24ClNO6S/c25-17-7-5-14(23-22(30)21(29)20(28)18(11-27)32-23)9-15(17)10-16-6-8-19(33-16)12-1-3-13(4-2-12)24(26)31/h1-9,18,20-23,27-30H,10-11H2,(H2,26,31)/t18-,20-,21+,22?,23+/m1/s1 |
| InChIKey | HUGKINSVUIDASX-RCQZAVTASA-N |
| XLogP | 2.27 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |