C26H28O6S — CID 158700764
(1R,2S,3S,4R,5R)-1-(hydroxymethyl)-5-[4-methyl-3-[[5-(4-methylphenyl)thiophen-2-yl]methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (PubChem CID 158700764) has the molecular formula C26H28O6S and a molecular weight of 468.57 g/mol. Its IUPAC name is (1R,2S,3S,4R,5R)-1-(hydroxymethyl)-5-[4-methyl-3-[[5-(4-methylphenyl)thiophen-2-yl]methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol.
| Compound Name | (1R,2S,3S,4R,5R)-1-(hydroxymethyl)-5-[4-methyl-3-[[5-(4-methylphenyl)thiophen-2-yl]methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
|---|---|
| PubChem CID | 158700764 |
| Molecular Formula | C26H28O6S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (1R,2S,3S,4R,5R)-1-(hydroxymethyl)-5-[4-methyl-3-[[5-(4-methylphenyl)thiophen-2-yl]methyl]phenyl]-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| SMILES | Cc1ccc(-c2ccc(Cc3cc([C@@]45OC[C@@](CO)(O4)[C@@H](O)[C@H](O)[C@H]5O)ccc3C)s2)cc1 |
| InChI | InChI=1S/C26H28O6S/c1-15-3-6-17(7-4-15)21-10-9-20(33-21)12-18-11-19(8-5-16(18)2)26-24(30)22(28)23(29)25(13-27,32-26)14-31-26/h3-11,22-24,27-30H,12-14H2,1-2H3/t22-,23-,24+,25+,26+/m0/s1 |
| InChIKey | KIEFUDBUYJDCMV-FZPKUJNRSA-N |
| XLogP | 2.65 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |