C26H28O6S — CID 140930606
(3S,3'R,4'S,5'S,6'R)-5-[[5-(4-methoxyphenyl)thiophen-2-yl]methyl]-6,6'-dimethylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 140930606) has the molecular formula C26H28O6S and a molecular weight of 468.57 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-5-[[5-(4-methoxyphenyl)thiophen-2-yl]methyl]-6,6'-dimethylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-5-[[5-(4-methoxyphenyl)thiophen-2-yl]methyl]-6,6'-dimethylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 140930606 |
| Molecular Formula | C26H28O6S |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-5-[[5-(4-methoxyphenyl)thiophen-2-yl]methyl]-6,6'-dimethylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | COc1ccc(-c2ccc(Cc3cc4c(cc3C)CO[C@]43O[C@H](C)[C@@H](O)[C@H](O)[C@H]3O)s2)cc1 |
| InChI | InChI=1S/C26H28O6S/c1-14-10-18-13-31-26(25(29)24(28)23(27)15(2)32-26)21(18)12-17(14)11-20-8-9-22(33-20)16-4-6-19(30-3)7-5-16/h4-10,12,15,23-25,27-29H,11,13H2,1-3H3/t15-,23-,24+,25-,26+/m1/s1 |
| InChIKey | GXZIGANIVAVCPP-YWIOKXSRSA-N |
| XLogP | 3.51 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |