C20H22ClFO5S — CID 134469501
(3S,3'R,4'S,5'S,6'R)-6-chloro-5-[(5-ethyl-4-fluorothiophen-2-yl)methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 134469501) has the molecular formula C20H22ClFO5S and a molecular weight of 428.91 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[(5-ethyl-4-fluorothiophen-2-yl)methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[(5-ethyl-4-fluorothiophen-2-yl)methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 134469501 |
| Molecular Formula | C20H22ClFO5S |
| Molecular Weight | 428.91 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[(5-ethyl-4-fluorothiophen-2-yl)methyl]-6'-methylspiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | CCc1sc(Cc2cc3c(cc2Cl)CO[C@]32O[C@H](C)[C@@H](O)[C@H](O)[C@H]2O)cc1F |
| InChI | InChI=1S/C20H22ClFO5S/c1-3-16-15(22)7-12(28-16)4-10-5-13-11(6-14(10)21)8-26-20(13)19(25)18(24)17(23)9(2)27-20/h5-7,9,17-19,23-25H,3-4,8H2,1-2H3/t9-,17-,18+,19-,20+/m1/s1 |
| InChIKey | KBCIPFJOBKGATA-QMLKOOCTSA-N |
| XLogP | 2.88 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.91 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |