C22H21F3O6 — CID 147602478
[4-(trifluoromethyl)phenyl]-[(3S,3'R,4'S,5'S,6'R)-3',4',5'-trihydroxy-6,6'-dimethylspiro[1H-2-benzofuran-3,2'-oxane]-5-yl]methanone (PubChem CID 147602478) has the molecular formula C22H21F3O6 and a molecular weight of 438.40 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]-[(3S,3'R,4'S,5'S,6'R)-3',4',5'-trihydroxy-6,6'-dimethylspiro[1H-2-benzofuran-3,2'-oxane]-5-yl]methanone.
| Compound Name | [4-(trifluoromethyl)phenyl]-[(3S,3'R,4'S,5'S,6'R)-3',4',5'-trihydroxy-6,6'-dimethylspiro[1H-2-benzofuran-3,2'-oxane]-5-yl]methanone |
|---|---|
| PubChem CID | 147602478 |
| Molecular Formula | C22H21F3O6 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]-[(3S,3'R,4'S,5'S,6'R)-3',4',5'-trihydroxy-6,6'-dimethylspiro[1H-2-benzofuran-3,2'-oxane]-5-yl]methanone |
| SMILES | Cc1cc2c(cc1C(=O)c1ccc(C(F)(F)F)cc1)[C@]1(OC2)O[C@H](C)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H21F3O6/c1-10-7-13-9-30-21(20(29)19(28)17(26)11(2)31-21)16(13)8-15(10)18(27)12-3-5-14(6-4-12)22(23,24)25/h3-8,11,17,19-20,26,28-29H,9H2,1-2H3/t11-,17-,19+,20-,21+/m1/s1 |
| InChIKey | GAKMTUOEYFXVQV-QBNVJHRZSA-N |
| XLogP | 2.43 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |