C21H21NO5S2 — CID 135360589
(3S,3'R,4'S,5'S,6'R)-6'-methyl-5-[(5-thiophen-2-yl-1,3-thiazol-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol (PubChem CID 135360589) has the molecular formula C21H21NO5S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6'-methyl-5-[(5-thiophen-2-yl-1,3-thiazol-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6'-methyl-5-[(5-thiophen-2-yl-1,3-thiazol-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 135360589 |
| Molecular Formula | C21H21NO5S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6'-methyl-5-[(5-thiophen-2-yl-1,3-thiazol-2-yl)methyl]spiro[1H-2-benzofuran-3,2'-oxane]-3',4',5'-triol |
| SMILES | C[C@H]1O[C@]2(OCc3ccc(Cc4ncc(-c5cccs5)s4)cc32)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H21NO5S2/c1-11-18(23)19(24)20(25)21(27-11)14-7-12(4-5-13(14)10-26-21)8-17-22-9-16(29-17)15-3-2-6-28-15/h2-7,9,11,18-20,23-25H,8,10H2,1H3/t11-,18-,19+,20-,21+/m1/s1 |
| InChIKey | KLYUTNWGYFGTSA-YIVYVHBTSA-N |
| XLogP | 2.65 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |