C19H17F3O5S — CID 70138434
[4-(trifluoromethyl)phenyl]-[4-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanylphenyl]methanone (PubChem CID 70138434) has the molecular formula C19H17F3O5S and a molecular weight of 414.40 g/mol. Its IUPAC name is [4-(trifluoromethyl)phenyl]-[4-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanylphenyl]methanone.
| Compound Name | [4-(trifluoromethyl)phenyl]-[4-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanylphenyl]methanone |
|---|---|
| PubChem CID | 70138434 |
| Molecular Formula | C19H17F3O5S |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | [4-(trifluoromethyl)phenyl]-[4-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]sulfanylphenyl]methanone |
| SMILES | O=C(c1ccc(S[C@H]2OC[C@@H](O)[C@H](O)[C@H]2O)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3O5S/c20-19(21,22)12-5-1-10(2-6-12)15(24)11-3-7-13(8-4-11)28-18-17(26)16(25)14(23)9-27-18/h1-8,14,16-18,23,25-26H,9H2/t14-,16+,17-,18-/m1/s1 |
| InChIKey | ZEPPNQZAQYKOJY-BZZMCLGOSA-N |
| XLogP | 2.47 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |