C22H24O7 — CID 169098183
(3R,3'R,4'S,5'S,6'R)-5-[(4-ethylphenyl)methyl]-3',4',5'-trihydroxy-6'-(hydroxymethyl)spiro[2-benzofuran-3,2'-oxane]-1-one (PubChem CID 169098183) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is (3R,3'R,4'S,5'S,6'R)-5-[(4-ethylphenyl)methyl]-3',4',5'-trihydroxy-6'-(hydroxymethyl)spiro[2-benzofuran-3,2'-oxane]-1-one.
| Compound Name | (3R,3'R,4'S,5'S,6'R)-5-[(4-ethylphenyl)methyl]-3',4',5'-trihydroxy-6'-(hydroxymethyl)spiro[2-benzofuran-3,2'-oxane]-1-one |
|---|---|
| PubChem CID | 169098183 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (3R,3'R,4'S,5'S,6'R)-5-[(4-ethylphenyl)methyl]-3',4',5'-trihydroxy-6'-(hydroxymethyl)spiro[2-benzofuran-3,2'-oxane]-1-one |
| SMILES | CCc1ccc(Cc2ccc3c(c2)[C@]2(OC3=O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C22H24O7/c1-2-12-3-5-13(6-4-12)9-14-7-8-15-16(10-14)22(29-21(15)27)20(26)19(25)18(24)17(11-23)28-22/h3-8,10,17-20,23-26H,2,9,11H2,1H3/t17-,18-,19+,20-,22-/m1/s1 |
| InChIKey | CIIIAHCNCPVXNH-OUUKCGNVSA-N |
| XLogP | 0.64 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |