C21H26O5 — CID 59460347
(2S,3R,4S,5S,6R)-2-(5-benzyl-2-methylphenyl)-6-(hydroxymethyl)-2-methyloxane-3,4,5-triol (PubChem CID 59460347) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(5-benzyl-2-methylphenyl)-6-(hydroxymethyl)-2-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(5-benzyl-2-methylphenyl)-6-(hydroxymethyl)-2-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 59460347 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(5-benzyl-2-methylphenyl)-6-(hydroxymethyl)-2-methyloxane-3,4,5-triol |
| SMILES | Cc1ccc(Cc2ccccc2)cc1[C@]1(C)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H26O5/c1-13-8-9-15(10-14-6-4-3-5-7-14)11-16(13)21(2)20(25)19(24)18(23)17(12-22)26-21/h3-9,11,17-20,22-25H,10,12H2,1-2H3/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | JUWLDBHJUWZHAW-ADAARDCZSA-N |
| XLogP | 1.27 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |