C23H27ClO6 — CID 59467879
(3S,3'R,4'S,5'S,6'R)-6-chloro-5-[(4-ethoxyphenyl)methyl]-6'-(hydroxymethyl)spiro[1,2-dihydroindene-3,2'-oxane]-3',4',5'-triol (PubChem CID 59467879) has the molecular formula C23H27ClO6 and a molecular weight of 434.92 g/mol. Its IUPAC name is (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[(4-ethoxyphenyl)methyl]-6'-(hydroxymethyl)spiro[1,2-dihydroindene-3,2'-oxane]-3',4',5'-triol.
| Compound Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[(4-ethoxyphenyl)methyl]-6'-(hydroxymethyl)spiro[1,2-dihydroindene-3,2'-oxane]-3',4',5'-triol |
|---|---|
| PubChem CID | 59467879 |
| Molecular Formula | C23H27ClO6 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (3S,3'R,4'S,5'S,6'R)-6-chloro-5-[(4-ethoxyphenyl)methyl]-6'-(hydroxymethyl)spiro[1,2-dihydroindene-3,2'-oxane]-3',4',5'-triol |
| SMILES | CCOc1ccc(Cc2cc3c(cc2Cl)CC[C@]32O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C23H27ClO6/c1-2-29-16-5-3-13(4-6-16)9-15-10-17-14(11-18(15)24)7-8-23(17)22(28)21(27)20(26)19(12-25)30-23/h3-6,10-11,19-22,25-28H,2,7-9,12H2,1H3/t19-,20-,21+,22-,23+/m1/s1 |
| InChIKey | RWRLMAQABSLWEC-ZQGJOIPISA-N |
| XLogP | 1.94 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |