C24H27NO5 — CID 143526204
4-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]-2-[[4-(oxolan-3-yloxy)phenyl]methyl]benzonitrile (PubChem CID 143526204) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 4-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]-2-[[4-(oxolan-3-yloxy)phenyl]methyl]benzonitrile.
| Compound Name | 4-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]-2-[[4-(oxolan-3-yloxy)phenyl]methyl]benzonitrile |
|---|---|
| PubChem CID | 143526204 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 4-[4-hydroxy-6-(hydroxymethyl)oxan-2-yl]-2-[[4-(oxolan-3-yloxy)phenyl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(C2CC(O)CC(CO)O2)cc1Cc1ccc(OC2CCOC2)cc1 |
| InChI | InChI=1S/C24H27NO5/c25-13-18-4-3-17(24-12-20(27)11-23(14-26)30-24)10-19(18)9-16-1-5-21(6-2-16)29-22-7-8-28-15-22/h1-6,10,20,22-24,26-27H,7-9,11-12,14-15H2 |
| InChIKey | PKPLYUNZKAGYGC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |