C26H32ClNO6 — CID 154632672
(5R,6S,7S)-3a-[4-chloro-3-[(4-propan-2-yloxyphenyl)methyl]phenyl]-5-(hydroxymethyl)-2-propyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol (PubChem CID 154632672) has the molecular formula C26H32ClNO6 and a molecular weight of 490.00 g/mol. Its IUPAC name is (5R,6S,7S)-3a-[4-chloro-3-[(4-propan-2-yloxyphenyl)methyl]phenyl]-5-(hydroxymethyl)-2-propyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol.
| Compound Name | (5R,6S,7S)-3a-[4-chloro-3-[(4-propan-2-yloxyphenyl)methyl]phenyl]-5-(hydroxymethyl)-2-propyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol |
|---|---|
| PubChem CID | 154632672 |
| Molecular Formula | C26H32ClNO6 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | (5R,6S,7S)-3a-[4-chloro-3-[(4-propan-2-yloxyphenyl)methyl]phenyl]-5-(hydroxymethyl)-2-propyl-5,6,7,7a-tetrahydropyrano[2,3-d][1,3]oxazole-6,7-diol |
| SMILES | CCCC1=NC2(c3ccc(Cl)c(Cc4ccc(OC(C)C)cc4)c3)O[C@H](CO)[C@@H](O)[C@H](O)C2O1 |
| InChI | InChI=1S/C26H32ClNO6/c1-4-5-22-28-26(25(33-22)24(31)23(30)21(14-29)34-26)18-8-11-20(27)17(13-18)12-16-6-9-19(10-7-16)32-15(2)3/h6-11,13,15,21,23-25,29-31H,4-5,12,14H2,1-3H3/t21-,23-,24+,25?,26?/m1/s1 |
| InChIKey | URXZXCZRIJKNOD-KUNPPPFKSA-N |
| XLogP | 3.58 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |