C24H29ClO8 — CID 122415252
(3R,4S,5S,6R)-2-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 122415252) has the molecular formula C24H29ClO8 and a molecular weight of 480.94 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5S,6R)-2-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 122415252 |
| Molecular Formula | C24H29ClO8 |
| Molecular Weight | 480.94 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | (3R,4S,5S,6R)-2-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@H]1OC(O)(c2ccc(Cl)c(Cc3ccc(OCCOC4CC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H29ClO8/c25-19-8-3-16(24(30)23(29)22(28)21(27)20(13-26)33-24)12-15(19)11-14-1-4-17(5-2-14)31-9-10-32-18-6-7-18/h1-5,8,12,18,20-23,26-30H,6-7,9-11,13H2/t20-,21-,22+,23-,24?/m1/s1 |
| InChIKey | IQGIFNWWOBQEIR-MLYSRARTSA-N |
| XLogP | 1.11 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.94 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|