C24H29ClO6 — CID 134485158
(3S)-6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 134485158) has the molecular formula C24H29ClO6 and a molecular weight of 448.94 g/mol. Its IUPAC name is (3S)-6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (3S)-6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 134485158 |
| Molecular Formula | C24H29ClO6 |
| Molecular Weight | 448.94 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (3S)-6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | OCC1OC(c2ccc(Cl)c(Cc3ccc(OCCOC4CC4)cc3)c2)CC(O)[C@@H]1O |
| InChI | InChI=1S/C24H29ClO6/c25-20-8-3-16(22-13-21(27)24(28)23(14-26)31-22)12-17(20)11-15-1-4-18(5-2-15)29-9-10-30-19-6-7-19/h1-5,8,12,19,21-24,26-28H,6-7,9-11,13-14H2/t21?,22?,23?,24-/m0/s1 |
| InChIKey | OQNPIVZVNZYCNI-GVWQBGCGSA-N |
| XLogP | 3.03 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.94 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|