C24H30ClNO3 — CID 176944268
[6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]oxan-2-yl]methanamine (PubChem CID 176944268) has the molecular formula C24H30ClNO3 and a molecular weight of 415.96 g/mol. Its IUPAC name is [6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]oxan-2-yl]methanamine.
| Compound Name | [6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]oxan-2-yl]methanamine |
|---|---|
| PubChem CID | 176944268 |
| Molecular Formula | C24H30ClNO3 |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | [6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]oxan-2-yl]methanamine |
| SMILES | NCC1CCCC(c2ccc(Cl)c(Cc3ccc(OCCOC4CC4)cc3)c2)O1 |
| InChI | InChI=1S/C24H30ClNO3/c25-23-11-6-18(24-3-1-2-22(16-26)29-24)15-19(23)14-17-4-7-20(8-5-17)27-12-13-28-21-9-10-21/h4-8,11,15,21-22,24H,1-3,9-10,12-14,16,26H2 |
| InChIKey | PJDXHYOAJBDICZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|