C18H18BrClO2 — CID 59557755
4-bromo-1-chloro-2-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]benzene (PubChem CID 59557755) has the molecular formula C18H18BrClO2 and a molecular weight of 381.70 g/mol. Its IUPAC name is 4-bromo-1-chloro-2-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]benzene.
| Compound Name | 4-bromo-1-chloro-2-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 59557755 |
| Molecular Formula | C18H18BrClO2 |
| Molecular Weight | 381.70 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 4-bromo-1-chloro-2-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]benzene |
| SMILES | Clc1ccc(Br)cc1Cc1ccc(OCCOC2CC2)cc1 |
| InChI | InChI=1S/C18H18BrClO2/c19-15-3-8-18(20)14(12-15)11-13-1-4-16(5-2-13)21-9-10-22-17-6-7-17/h1-5,8,12,17H,6-7,9-11H2 |
| InChIKey | RMJWBNIWLGMQDS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.70 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|