C24H31ClO6 — CID 130305846
(2R,4R)-6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]hexane-1,2,4,6-tetrol (PubChem CID 130305846) has the molecular formula C24H31ClO6 and a molecular weight of 450.96 g/mol. Its IUPAC name is (2R,4R)-6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]hexane-1,2,4,6-tetrol.
| Compound Name | (2R,4R)-6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]hexane-1,2,4,6-tetrol |
|---|---|
| PubChem CID | 130305846 |
| Molecular Formula | C24H31ClO6 |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (2R,4R)-6-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]hexane-1,2,4,6-tetrol |
| SMILES | OC[C@H](O)C[C@H](O)CC(O)c1ccc(Cl)c(Cc2ccc(OCCOC3CC3)cc2)c1 |
| InChI | InChI=1S/C24H31ClO6/c25-23-8-3-17(24(29)14-19(27)13-20(28)15-26)12-18(23)11-16-1-4-21(5-2-16)30-9-10-31-22-6-7-22/h1-5,8,12,19-20,22,24,26-29H,6-7,9-11,13-15H2/t19-,20+,24?/m0/s1 |
| InChIKey | JRQOMFCLBVTCJL-ZPVKFHTISA-N |
| XLogP | 3.02 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|